C19H21N3O — CID 71205643
2-(cyclohexanecarbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-6-carbonitrile (PubChem CID 71205643) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-(cyclohexanecarbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-6-carbonitrile.
| Compound Name | 2-(cyclohexanecarbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-6-carbonitrile |
|---|---|
| PubChem CID | 71205643 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-(cyclohexanecarbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-6-carbonitrile |
| SMILES | N#Cc1cccc2c3c([nH]c12)CCN(C(=O)C1CCCCC1)C3 |
| InChI | InChI=1S/C19H21N3O/c20-11-14-7-4-8-15-16-12-22(10-9-17(16)21-18(14)15)19(23)13-5-2-1-3-6-13/h4,7-8,13,21H,1-3,5-6,9-10,12H2 |
| InChIKey | ZOIBNBBQZDCMNG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|