C26H32N4O3 — CID 68573118
N-(1-cyanocyclopropyl)-2-(6-propoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)cyclohexane-1-carboxamide (PubChem CID 68573118) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-2-(6-propoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)cyclohexane-1-carboxamide.
| Compound Name | N-(1-cyanocyclopropyl)-2-(6-propoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 68573118 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N-(1-cyanocyclopropyl)-2-(6-propoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)cyclohexane-1-carboxamide |
| SMILES | CCCOc1cccc2c3c([nH]c12)CCN(C(=O)C1CCCCC1C(=O)NC1(C#N)CC1)C3 |
| InChI | InChI=1S/C26H32N4O3/c1-2-14-33-22-9-5-8-17-20-15-30(13-10-21(20)28-23(17)22)25(32)19-7-4-3-6-18(19)24(31)29-26(16-27)11-12-26/h5,8-9,18-19,28H,2-4,6-7,10-15H2,1H3,(H,29,31) |
| InChIKey | ZASVBBCQLDAKGY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|