C18H23N3O2 — CID 110667981
N-cyclopentyl-6-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide (PubChem CID 110667981) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-cyclopentyl-6-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide.
| Compound Name | N-cyclopentyl-6-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 110667981 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-cyclopentyl-6-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
| SMILES | COc1cccc2c3c([nH]c12)CCN(C(=O)NC1CCCC1)C3 |
| InChI | InChI=1S/C18H23N3O2/c1-23-16-8-4-7-13-14-11-21(10-9-15(14)20-17(13)16)18(22)19-12-5-2-3-6-12/h4,7-8,12,20H,2-3,5-6,9-11H2,1H3,(H,19,22) |
| InChIKey | BNXIUVRHPWLZNI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|