C18H23N3O — CID 113089438
N-cyclopropyl-8-propan-2-yl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide (PubChem CID 113089438) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-cyclopropyl-8-propan-2-yl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide.
| Compound Name | N-cyclopropyl-8-propan-2-yl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 113089438 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-cyclopropyl-8-propan-2-yl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
| SMILES | CC(C)c1ccc2[nH]c3c(c2c1)CN(C(=O)NC1CC1)CC3 |
| InChI | InChI=1S/C18H23N3O/c1-11(2)12-3-6-16-14(9-12)15-10-21(8-7-17(15)20-16)18(22)19-13-4-5-13/h3,6,9,11,13,20H,4-5,7-8,10H2,1-2H3,(H,19,22) |
| InChIKey | DQDXNQCPTFCDJF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|