C22H27F2N3O3 — CID 68591101
tert-butyl 8-(4,4-difluoropiperidine-1-carbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate (PubChem CID 68591101) has the molecular formula C22H27F2N3O3 and a molecular weight of 419.47 g/mol. Its IUPAC name is tert-butyl 8-(4,4-difluoropiperidine-1-carbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate.
| Compound Name | tert-butyl 8-(4,4-difluoropiperidine-1-carbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 68591101 |
| Molecular Formula | C22H27F2N3O3 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | tert-butyl 8-(4,4-difluoropiperidine-1-carbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2[nH]c3ccc(C(=O)N4CCC(F)(F)CC4)cc3c2C1 |
| InChI | InChI=1S/C22H27F2N3O3/c1-21(2,3)30-20(29)27-9-6-18-16(13-27)15-12-14(4-5-17(15)25-18)19(28)26-10-7-22(23,24)8-11-26/h4-5,12,25H,6-11,13H2,1-3H3 |
| InChIKey | SSDWVFYSVWUNQF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|