C16H18N2O2 — CID 110667876
cyclopropyl-(6-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 110667876) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is cyclopropyl-(6-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | cyclopropyl-(6-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 110667876 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | cyclopropyl-(6-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | COc1cccc2c3c([nH]c12)CCN(C(=O)C1CC1)C3 |
| InChI | InChI=1S/C16H18N2O2/c1-20-14-4-2-3-11-12-9-18(16(19)10-5-6-10)8-7-13(12)17-15(11)14/h2-4,10,17H,5-9H2,1H3 |
| InChIKey | BFWJHVUJCDUMQW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|