C15H12Cl2N4O — CID 169197002
(6,7-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(1H-imidazol-2-yl)methanone (PubChem CID 169197002) has the molecular formula C15H12Cl2N4O and a molecular weight of 335.19 g/mol. Its IUPAC name is (6,7-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(1H-imidazol-2-yl)methanone.
| Compound Name | (6,7-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(1H-imidazol-2-yl)methanone |
|---|---|
| PubChem CID | 169197002 |
| Molecular Formula | C15H12Cl2N4O |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | (6,7-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(1H-imidazol-2-yl)methanone |
| SMILES | O=C(c1ncc[nH]1)N1CCc2[nH]c3c(Cl)c(Cl)ccc3c2C1 |
| InChI | InChI=1S/C15H12Cl2N4O/c16-10-2-1-8-9-7-21(15(22)14-18-4-5-19-14)6-3-11(9)20-13(8)12(10)17/h1-2,4-5,20H,3,6-7H2,(H,18,19) |
| InChIKey | MUAXVHXUKCQBLQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|