C22H26N4O — CID 46964909
(2-tert-butylpyrimidin-5-yl)-(6,7-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 46964909) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is (2-tert-butylpyrimidin-5-yl)-(6,7-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | (2-tert-butylpyrimidin-5-yl)-(6,7-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 46964909 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (2-tert-butylpyrimidin-5-yl)-(6,7-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | Cc1ccc2c3c([nH]c2c1C)CCN(C(=O)c1cnc(C(C)(C)C)nc1)C3 |
| InChI | InChI=1S/C22H26N4O/c1-13-6-7-16-17-12-26(9-8-18(17)25-19(16)14(13)2)20(27)15-10-23-21(24-11-15)22(3,4)5/h6-7,10-11,25H,8-9,12H2,1-5H3 |
| InChIKey | VHKZYEMKDLFSSL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|