C17H13Cl2N3O — CID 46843289
(2-chlorophenyl)-(12-chloro-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-4-yl)methanone (PubChem CID 46843289) has the molecular formula C17H13Cl2N3O and a molecular weight of 346.22 g/mol. Its IUPAC name is (2-chlorophenyl)-(12-chloro-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-4-yl)methanone.
| Compound Name | (2-chlorophenyl)-(12-chloro-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-4-yl)methanone |
|---|---|
| PubChem CID | 46843289 |
| Molecular Formula | C17H13Cl2N3O |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | (2-chlorophenyl)-(12-chloro-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-4-yl)methanone |
| SMILES | O=C(c1ccccc1Cl)N1CCc2[nH]c3ncc(Cl)cc3c2C1 |
| InChI | InChI=1S/C17H13Cl2N3O/c18-10-7-12-13-9-22(6-5-15(13)21-16(12)20-8-10)17(23)11-3-1-2-4-14(11)19/h1-4,7-8H,5-6,9H2,(H,20,21) |
| InChIKey | FCVOXRUJMWSMKG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |