C16H20ClN3O2 — CID 162388693
tert-butyl 4-chloro-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene-12-carboxylate (PubChem CID 162388693) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is tert-butyl 4-chloro-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene-12-carboxylate.
| Compound Name | tert-butyl 4-chloro-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 162388693 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | tert-butyl 4-chloro-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2[nH]c3ncc(Cl)cc3c2CC1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-16(2,3)22-15(21)20-6-4-11-12-8-10(17)9-18-14(12)19-13(11)5-7-20/h8-9H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | FKBCRFZNNCKONX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |