C17H14Cl2N4O2 — CID 169197364
2-[(1R)-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl]-1H-pyrimidin-6-one (PubChem CID 169197364) has the molecular formula C17H14Cl2N4O2 and a molecular weight of 377.23 g/mol. Its IUPAC name is 2-[(1R)-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[(1R)-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 169197364 |
| Molecular Formula | C17H14Cl2N4O2 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2-[(1R)-6,7-dichloro-1-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl]-1H-pyrimidin-6-one |
| SMILES | C[C@@H]1c2c([nH]c3c(Cl)c(Cl)ccc23)CCN1C(=O)c1nccc(=O)[nH]1 |
| InChI | InChI=1S/C17H14Cl2N4O2/c1-8-13-9-2-3-10(18)14(19)15(9)21-11(13)5-7-23(8)17(25)16-20-6-4-12(24)22-16/h2-4,6,8,21H,5,7H2,1H3,(H,20,22,24)/t8-/m1/s1 |
| InChIKey | XTCUEZYYOHHZGA-MRVPVSSYSA-N |
| XLogP | 3.32 |
| TPSA | 81.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|