C20H26N2O3 — CID 95136848
[(2R)-1,4-dioxan-2-yl]-[4-(7-ethyl-1H-indol-3-yl)piperidin-1-yl]methanone (PubChem CID 95136848) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is [(2R)-1,4-dioxan-2-yl]-[4-(7-ethyl-1H-indol-3-yl)piperidin-1-yl]methanone.
| Compound Name | [(2R)-1,4-dioxan-2-yl]-[4-(7-ethyl-1H-indol-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95136848 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | [(2R)-1,4-dioxan-2-yl]-[4-(7-ethyl-1H-indol-3-yl)piperidin-1-yl]methanone |
| SMILES | CCc1cccc2c(C3CCN(C(=O)[C@H]4COCCO4)CC3)c[nH]c12 |
| InChI | InChI=1S/C20H26N2O3/c1-2-14-4-3-5-16-17(12-21-19(14)16)15-6-8-22(9-7-15)20(23)18-13-24-10-11-25-18/h3-5,12,15,18,21H,2,6-11,13H2,1H3/t18-/m1/s1 |
| InChIKey | LVVWTDHTXQPOEZ-GOSISDBHSA-N |
| XLogP | 2.85 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |