C23H30N4O — CID 87030920
N-(1-cyanocyclopentyl)-2-[4-(7-ethyl-1H-indol-3-yl)piperidin-1-yl]acetamide (PubChem CID 87030920) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is N-(1-cyanocyclopentyl)-2-[4-(7-ethyl-1H-indol-3-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(1-cyanocyclopentyl)-2-[4-(7-ethyl-1H-indol-3-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 87030920 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N-(1-cyanocyclopentyl)-2-[4-(7-ethyl-1H-indol-3-yl)piperidin-1-yl]acetamide |
| SMILES | CCc1cccc2c(C3CCN(CC(=O)NC4(C#N)CCCC4)CC3)c[nH]c12 |
| InChI | InChI=1S/C23H30N4O/c1-2-17-6-5-7-19-20(14-25-22(17)19)18-8-12-27(13-9-18)15-21(28)26-23(16-24)10-3-4-11-23/h5-7,14,18,25H,2-4,8-13,15H2,1H3,(H,26,28) |
| InChIKey | HUAOWQGYFVLKJE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |