C24H35N5O2 — CID 55538320
2-[4-[2-[(1-cyanocycloheptyl)amino]-2-oxoethyl]piperazin-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 55538320) has the molecular formula C24H35N5O2 and a molecular weight of 425.58 g/mol. Its IUPAC name is 2-[4-[2-[(1-cyanocycloheptyl)amino]-2-oxoethyl]piperazin-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[4-[2-[(1-cyanocycloheptyl)amino]-2-oxoethyl]piperazin-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 55538320 |
| Molecular Formula | C24H35N5O2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | 2-[4-[2-[(1-cyanocycloheptyl)amino]-2-oxoethyl]piperazin-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(CC(=O)NC2(C#N)CCCCCC2)CC1 |
| InChI | InChI=1S/C24H35N5O2/c1-2-20-9-5-6-10-21(20)26-22(30)17-28-13-15-29(16-14-28)18-23(31)27-24(19-25)11-7-3-4-8-12-24/h5-6,9-10H,2-4,7-8,11-18H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | AQGYKISKQTZAGX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |