C22H32N4O2 — CID 55537421
N-(1-cyanocycloheptyl)-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide (PubChem CID 55537421) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is N-(1-cyanocycloheptyl)-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(1-cyanocycloheptyl)-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55537421 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | N-(1-cyanocycloheptyl)-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide |
| SMILES | N#CC1(NC(=O)CN2CCN(CCOc3ccccc3)CC2)CCCCCC1 |
| InChI | InChI=1S/C22H32N4O2/c23-19-22(10-6-1-2-7-11-22)24-21(27)18-26-14-12-25(13-15-26)16-17-28-20-8-4-3-5-9-20/h3-5,8-9H,1-2,6-7,10-18H2,(H,24,27) |
| InChIKey | AYBYHQFSOGCTQG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |