C14H17NO5 — CID 43623087
methyl 2-[1,4-dioxane-2-carbonyl(methyl)amino]benzoate (PubChem CID 43623087) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is methyl 2-[1,4-dioxane-2-carbonyl(methyl)amino]benzoate.
| Compound Name | methyl 2-[1,4-dioxane-2-carbonyl(methyl)amino]benzoate |
|---|---|
| PubChem CID | 43623087 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | methyl 2-[1,4-dioxane-2-carbonyl(methyl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)C(=O)C1COCCO1 |
| InChI | InChI=1S/C14H17NO5/c1-15(13(16)12-9-19-7-8-20-12)11-6-4-3-5-10(11)14(17)18-2/h3-6,12H,7-9H2,1-2H3 |
| InChIKey | YYPSNOSLCISWHW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |