C19H20BrN3O — CID 127252975
1-(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(2,5-dimethylpyrrol-1-yl)ethanone (PubChem CID 127252975) has the molecular formula C19H20BrN3O and a molecular weight of 386.29 g/mol. Its IUPAC name is 1-(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(2,5-dimethylpyrrol-1-yl)ethanone.
| Compound Name | 1-(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(2,5-dimethylpyrrol-1-yl)ethanone |
|---|---|
| PubChem CID | 127252975 |
| Molecular Formula | C19H20BrN3O |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 1-(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(2,5-dimethylpyrrol-1-yl)ethanone |
| SMILES | Cc1ccc(C)n1CC(=O)N1CCc2[nH]c3c(Br)cccc3c2C1 |
| InChI | InChI=1S/C19H20BrN3O/c1-12-6-7-13(2)23(12)11-18(24)22-9-8-17-15(10-22)14-4-3-5-16(20)19(14)21-17/h3-7,21H,8-11H2,1-2H3 |
| InChIKey | GCXRAKUWWJDCQX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|