C18H20N4O3 — CID 97119685
(5S)-5-[3-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 97119685) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is (5S)-5-[3-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[3-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97119685 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (5S)-5-[3-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc2c3c([nH]c12)CCN(C(=O)CC[C@@H]1NC(=O)NC1=O)C3 |
| InChI | InChI=1S/C18H20N4O3/c1-10-3-2-4-11-12-9-22(8-7-13(12)19-16(10)11)15(23)6-5-14-17(24)21-18(25)20-14/h2-4,14,19H,5-9H2,1H3,(H2,20,21,24,25)/t14-/m0/s1 |
| InChIKey | WUJSTIHMPGGZKJ-AWEZNQCLSA-N |
| XLogP | 1.35 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|