C18H22N4O4 — CID 97118518
(5R)-5-[3-[4-[(3-methylphenyl)methyl]-3-oxopiperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 97118518) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is (5R)-5-[3-[4-[(3-methylphenyl)methyl]-3-oxopiperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[3-[4-[(3-methylphenyl)methyl]-3-oxopiperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97118518 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (5R)-5-[3-[4-[(3-methylphenyl)methyl]-3-oxopiperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(CN2CCN(C(=O)CC[C@H]3NC(=O)NC3=O)CC2=O)c1 |
| InChI | InChI=1S/C18H22N4O4/c1-12-3-2-4-13(9-12)10-21-7-8-22(11-16(21)24)15(23)6-5-14-17(25)20-18(26)19-14/h2-4,9,14H,5-8,10-11H2,1H3,(H2,19,20,25,26)/t14-/m1/s1 |
| InChIKey | KRGLUEVQDKGRIR-CQSZACIVSA-N |
| XLogP | 0.15 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|