C17H20N6O3 — CID 131951277
2-[5-[2-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-1-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]acetamide (PubChem CID 131951277) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-[5-[2-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-1-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]acetamide.
| Compound Name | 2-[5-[2-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-1-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]acetamide |
|---|---|
| PubChem CID | 131951277 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-[5-[2-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-1-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]acetamide |
| SMILES | Cc1cccc(Cn2nc(CC(N)=O)nc2CC[C@@H]2NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C17H20N6O3/c1-10-3-2-4-11(7-10)9-23-15(20-14(22-23)8-13(18)24)6-5-12-16(25)21-17(26)19-12/h2-4,7,12H,5-6,8-9H2,1H3,(H2,18,24)(H2,19,21,25,26)/t12-/m0/s1 |
| InChIKey | DLRVYVDIYWYJDY-LBPRGKRZSA-N |
| XLogP | -0.20 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|