C13H18N4 — CID 63274880
2-[(3-methylphenyl)methyl]-5-propyl-1,2,4-triazol-3-amine (PubChem CID 63274880) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methyl]-5-propyl-1,2,4-triazol-3-amine.
| Compound Name | 2-[(3-methylphenyl)methyl]-5-propyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 63274880 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-[(3-methylphenyl)methyl]-5-propyl-1,2,4-triazol-3-amine |
| SMILES | CCCc1nc(N)n(Cc2cccc(C)c2)n1 |
| InChI | InChI=1S/C13H18N4/c1-3-5-12-15-13(14)17(16-12)9-11-7-4-6-10(2)8-11/h4,6-8H,3,5,9H2,1-2H3,(H2,14,15,16) |
| InChIKey | KJOFWTUFRRVSQF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |