C10H13N5O — CID 121320242
1-[(3-methoxyphenyl)methyl]-1,2,4-triazole-3,5-diamine (PubChem CID 121320242) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 121320242 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-1,2,4-triazole-3,5-diamine |
| SMILES | COc1cccc(Cn2nc(N)nc2N)c1 |
| InChI | InChI=1S/C10H13N5O/c1-16-8-4-2-3-7(5-8)6-15-10(12)13-9(11)14-15/h2-5H,6H2,1H3,(H4,11,12,13,14) |
| InChIKey | USLUYNYDJJOYJS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |