C27H28N2O3 — CID 19586315
4-ethyl-3,5-bis(4-methoxyphenyl)-1-[(3-methoxyphenyl)methyl]pyrazole (PubChem CID 19586315) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 4-ethyl-3,5-bis(4-methoxyphenyl)-1-[(3-methoxyphenyl)methyl]pyrazole.
| Compound Name | 4-ethyl-3,5-bis(4-methoxyphenyl)-1-[(3-methoxyphenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 19586315 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 4-ethyl-3,5-bis(4-methoxyphenyl)-1-[(3-methoxyphenyl)methyl]pyrazole |
| SMILES | CCc1c(-c2ccc(OC)cc2)nn(Cc2cccc(OC)c2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H28N2O3/c1-5-25-26(20-9-13-22(30-2)14-10-20)28-29(18-19-7-6-8-24(17-19)32-4)27(25)21-11-15-23(31-3)16-12-21/h6-17H,5,18H2,1-4H3 |
| InChIKey | CXGBZAXJBBMZPT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |