C23H26N2O4 — CID 19587517
ethyl 2-[4-ethyl-3,5-bis(3-methoxyphenyl)pyrazol-1-yl]acetate (PubChem CID 19587517) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is ethyl 2-[4-ethyl-3,5-bis(3-methoxyphenyl)pyrazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-ethyl-3,5-bis(3-methoxyphenyl)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 19587517 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | ethyl 2-[4-ethyl-3,5-bis(3-methoxyphenyl)pyrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(-c2cccc(OC)c2)c(CC)c1-c1cccc(OC)c1 |
| InChI | InChI=1S/C23H26N2O4/c1-5-20-22(16-9-7-11-18(13-16)27-3)24-25(15-21(26)29-6-2)23(20)17-10-8-12-19(14-17)28-4/h7-14H,5-6,15H2,1-4H3 |
| InChIKey | OLUQBGORLLASJL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |