C21H21ClN2O4 — CID 19587044
ethyl 2-[4-chloro-3,5-bis(3-methoxyphenyl)pyrazol-1-yl]acetate (PubChem CID 19587044) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is ethyl 2-[4-chloro-3,5-bis(3-methoxyphenyl)pyrazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-chloro-3,5-bis(3-methoxyphenyl)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 19587044 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | ethyl 2-[4-chloro-3,5-bis(3-methoxyphenyl)pyrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(-c2cccc(OC)c2)c(Cl)c1-c1cccc(OC)c1 |
| InChI | InChI=1S/C21H21ClN2O4/c1-4-28-18(25)13-24-21(15-8-6-10-17(12-15)27-3)19(22)20(23-24)14-7-5-9-16(11-14)26-2/h5-12H,4,13H2,1-3H3 |
| InChIKey | HDKXXHXRGLLAKG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |