C10H9Br2N3O — CID 50999870
3,5-dibromo-1-[(3-methoxyphenyl)methyl]-1,2,4-triazole (PubChem CID 50999870) has the molecular formula C10H9Br2N3O and a molecular weight of 347.01 g/mol. Its IUPAC name is 3,5-dibromo-1-[(3-methoxyphenyl)methyl]-1,2,4-triazole.
| Compound Name | 3,5-dibromo-1-[(3-methoxyphenyl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 50999870 |
| Molecular Formula | C10H9Br2N3O |
| Molecular Weight | 347.01 g/mol |
| Exact Mass | 344.91 |
| IUPAC Name | 3,5-dibromo-1-[(3-methoxyphenyl)methyl]-1,2,4-triazole |
| SMILES | COc1cccc(Cn2nc(Br)nc2Br)c1 |
| InChI | InChI=1S/C10H9Br2N3O/c1-16-8-4-2-3-7(5-8)6-15-10(12)13-9(11)14-15/h2-5H,6H2,1H3 |
| InChIKey | XNAASPOSEPIBCO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.01 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |