About furan;1-methyl-3-propylbenzene
furan;1-methyl-3-propylbenzene (PubChem CID 90871497) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is furan;1-methyl-3-propylbenzene.
Molecular Properties
| Compound Name | furan;1-methyl-3-propylbenzene |
| PubChem CID | 90871497 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | furan;1-methyl-3-propylbenzene |
| SMILES | CCCc1cccc(C)c1.c1ccoc1 |
| InChI | InChI=1S/C10H14.C4H4O/c1-3-5-10-7-4-6-9(2)8-10;1-2-4-5-3-1/h4,6-8H,3,5H2,1-2H3;1-4H |
| InChIKey | WCQDRJFGFVFLGZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze furan;1-methyl-3-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan;1-methyl-3-propylbenzene?
The IUPAC name of furan;1-methyl-3-propylbenzene (CID 90871497) is furan;1-methyl-3-propylbenzene.
What is the SMILES notation for furan;1-methyl-3-propylbenzene?
The canonical SMILES for furan;1-methyl-3-propylbenzene is CCCc1cccc(C)c1.c1ccoc1.
What is the InChIKey of furan;1-methyl-3-propylbenzene?
The InChIKey is WCQDRJFGFVFLGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C4H4O/c1-3-5-10-7-4-6-9(2)8-10;1-2-4-5-3-1/h4,6-8H,3,5H2,1-2H3;1-4H.
What are the key properties of furan;1-methyl-3-propylbenzene?
furan;1-methyl-3-propylbenzene has a molecular weight of 202.30 g/mol, XLogP of 4.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for furan;1-methyl-3-propylbenzene is sourced from PubChem (CID 90871497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).