About 1-ethyl-3-methylbenzene;methanamine
1-ethyl-3-methylbenzene;methanamine (PubChem CID 167447790) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-ethyl-3-methylbenzene;methanamine.
Molecular Properties
| Compound Name | 1-ethyl-3-methylbenzene;methanamine |
| PubChem CID | 167447790 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-ethyl-3-methylbenzene;methanamine |
| SMILES | CCc1cccc(C)c1.CN |
| InChI | InChI=1S/C9H12.CH5N/c1-3-9-6-4-5-8(2)7-9;1-2/h4-7H,3H2,1-2H3;2H2,1H3 |
| InChIKey | WPTAXPOKCJXBEN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-3-methylbenzene;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methylbenzene;methanamine?
The IUPAC name of 1-ethyl-3-methylbenzene;methanamine (CID 167447790) is 1-ethyl-3-methylbenzene;methanamine.
What is the SMILES notation for 1-ethyl-3-methylbenzene;methanamine?
The canonical SMILES for 1-ethyl-3-methylbenzene;methanamine is CCc1cccc(C)c1.CN.
What is the InChIKey of 1-ethyl-3-methylbenzene;methanamine?
The InChIKey is WPTAXPOKCJXBEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.CH5N/c1-3-9-6-4-5-8(2)7-9;1-2/h4-7H,3H2,1-2H3;2H2,1H3.
What are the key properties of 1-ethyl-3-methylbenzene;methanamine?
1-ethyl-3-methylbenzene;methanamine has a molecular weight of 151.25 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methylbenzene;methanamine is sourced from PubChem (CID 167447790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).