About CID 142053159
CID 142053159 (PubChem CID 142053159) has the molecular formula C24H33
and a molecular weight of 321.53 g/mol.
Molecular Properties
| Compound Name | CID 142053159 |
| PubChem CID | 142053159 |
| Molecular Formula | C24H33 |
| Molecular Weight | 321.53 g/mol |
| Exact Mass | 321.26 |
| IUPAC Name | — |
| SMILES | CC.CC(C)(C)c1ccc([C]2C=C2)cc1.CCc1cccc(C)c1 |
| InChI | InChI=1S/C13H15.C9H12.C2H6/c1-13(2,3)12-8-6-11(7-9-12)10-4-5-10;1-3-9-6-4-5-8(2)7-9;1-2/h4-9H,1-3H3;4-7H,3H2,1-2H3;1-2H3 |
| InChIKey | FZJUCGXOXFOVIS-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.53 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 142053159 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142053159?
The IUPAC name of CID 142053159 (CID 142053159) is not available.
What is the SMILES notation for CID 142053159?
The canonical SMILES for CID 142053159 is CC.CC(C)(C)c1ccc([C]2C=C2)cc1.CCc1cccc(C)c1.
What is the InChIKey of CID 142053159?
The InChIKey is FZJUCGXOXFOVIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15.C9H12.C2H6/c1-13(2,3)12-8-6-11(7-9-12)10-4-5-10;1-3-9-6-4-5-8(2)7-9;1-2/h4-9H,1-3H3;4-7H,3H2,1-2H3;1-2H3.
What are the key properties of CID 142053159?
CID 142053159 has a molecular weight of 321.53 g/mol, XLogP of 7.06, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142053159 is sourced from PubChem (CID 142053159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).