About CID 142053160
CID 142053160 (PubChem CID 142053160) has the molecular formula C13H15
and a molecular weight of 171.26 g/mol.
Molecular Properties
| Compound Name | CID 142053160 |
| PubChem CID | 142053160 |
| Molecular Formula | C13H15 |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.12 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc([C]2C=C2)cc1 |
| InChI | InChI=1S/C13H15/c1-13(2,3)12-8-6-11(7-9-12)10-4-5-10/h4-9H,1-3H3 |
| InChIKey | CZSTXASDCJIRKA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 142053160 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142053160?
The IUPAC name of CID 142053160 (CID 142053160) is not available.
What is the SMILES notation for CID 142053160?
The canonical SMILES for CID 142053160 is CC(C)(C)c1ccc([C]2C=C2)cc1.
What is the InChIKey of CID 142053160?
The InChIKey is CZSTXASDCJIRKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15/c1-13(2,3)12-8-6-11(7-9-12)10-4-5-10/h4-9H,1-3H3.
What are the key properties of CID 142053160?
CID 142053160 has a molecular weight of 171.26 g/mol, XLogP of 3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142053160 is sourced from PubChem (CID 142053160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).