C26H32N2 — CID 143714645
2,5-bis(4-tert-butylphenyl)-3,6-dimethylpyrazine (PubChem CID 143714645) has the molecular formula C26H32N2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 2,5-bis(4-tert-butylphenyl)-3,6-dimethylpyrazine.
| Compound Name | 2,5-bis(4-tert-butylphenyl)-3,6-dimethylpyrazine |
|---|---|
| PubChem CID | 143714645 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 2,5-bis(4-tert-butylphenyl)-3,6-dimethylpyrazine |
| SMILES | Cc1nc(-c2ccc(C(C)(C)C)cc2)c(C)nc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H32N2/c1-17-23(19-9-13-21(14-10-19)25(3,4)5)28-18(2)24(27-17)20-11-15-22(16-12-20)26(6,7)8/h9-16H,1-8H3 |
| InChIKey | ZIQDRZFMAZVORG-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |