C14H16BrNOS — CID 131867651
[2-bromo-4-(4-tert-butylphenyl)-1,3-thiazol-5-yl]methanol (PubChem CID 131867651) has the molecular formula C14H16BrNOS and a molecular weight of 326.26 g/mol. Its IUPAC name is [2-bromo-4-(4-tert-butylphenyl)-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-bromo-4-(4-tert-butylphenyl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 131867651 |
| Molecular Formula | C14H16BrNOS |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | [2-bromo-4-(4-tert-butylphenyl)-1,3-thiazol-5-yl]methanol |
| SMILES | CC(C)(C)c1ccc(-c2nc(Br)sc2CO)cc1 |
| InChI | InChI=1S/C14H16BrNOS/c1-14(2,3)10-6-4-9(5-7-10)12-11(8-17)18-13(15)16-12/h4-7,17H,8H2,1-3H3 |
| InChIKey | JXSZVTFXAHOWES-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |