C17H21NO2S — CID 82069366
2-[4-(4-tert-butylphenyl)-2-ethyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 82069366) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-[4-(4-tert-butylphenyl)-2-ethyl-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[4-(4-tert-butylphenyl)-2-ethyl-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 82069366 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-[4-(4-tert-butylphenyl)-2-ethyl-1,3-thiazol-5-yl]acetic acid |
| SMILES | CCc1nc(-c2ccc(C(C)(C)C)cc2)c(CC(=O)O)s1 |
| InChI | InChI=1S/C17H21NO2S/c1-5-14-18-16(13(21-14)10-15(19)20)11-6-8-12(9-7-11)17(2,3)4/h6-9H,5,10H2,1-4H3,(H,19,20) |
| InChIKey | VOKXEPFZQUJQKT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |