About cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene
cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene (PubChem CID 142052943) has the molecular formula C22H34
and a molecular weight of 298.51 g/mol. Its IUPAC name is cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene.
Molecular Properties
| Compound Name | cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene |
| PubChem CID | 142052943 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene |
| SMILES | CC.CC.CCc1cccc(C)c1.c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C9H10.C9H12.2C2H6/c1-2-4-8(5-3-1)9-6-7-9;1-3-9-6-4-5-8(2)7-9;2*1-2/h1-5,9H,6-7H2;4-7H,3H2,1-2H3;2*1-2H3 |
| InChIKey | BTNBNFITEOLVRC-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene?
The IUPAC name of cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene (CID 142052943) is cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene.
What is the SMILES notation for cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene?
The canonical SMILES for cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene is CC.CC.CCc1cccc(C)c1.c1ccc(C2CC2)cc1.
What is the InChIKey of cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene?
The InChIKey is BTNBNFITEOLVRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C9H12.2C2H6/c1-2-4-8(5-3-1)9-6-7-9;1-3-9-6-4-5-8(2)7-9;2*1-2/h1-5,9H,6-7H2;4-7H,3H2,1-2H3;2*1-2H3.
What are the key properties of cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene?
cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene has a molecular weight of 298.51 g/mol, XLogP of 7.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylbenzene;ethane;1-ethyl-3-methylbenzene is sourced from PubChem (CID 142052943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).