About 1-methyl-3-propylbenzene;prop-2-enenitrile
1-methyl-3-propylbenzene;prop-2-enenitrile (PubChem CID 144542987) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-methyl-3-propylbenzene;prop-2-enenitrile.
Molecular Properties
| Compound Name | 1-methyl-3-propylbenzene;prop-2-enenitrile |
| PubChem CID | 144542987 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-methyl-3-propylbenzene;prop-2-enenitrile |
| SMILES | C=CC#N.CCCc1cccc(C)c1 |
| InChI | InChI=1S/C10H14.C3H3N/c1-3-5-10-7-4-6-9(2)8-10;1-2-3-4/h4,6-8H,3,5H2,1-2H3;2H,1H2 |
| InChIKey | UVEDFGYGGNNDGH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-propylbenzene;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-propylbenzene;prop-2-enenitrile?
The IUPAC name of 1-methyl-3-propylbenzene;prop-2-enenitrile (CID 144542987) is 1-methyl-3-propylbenzene;prop-2-enenitrile.
What is the SMILES notation for 1-methyl-3-propylbenzene;prop-2-enenitrile?
The canonical SMILES for 1-methyl-3-propylbenzene;prop-2-enenitrile is C=CC#N.CCCc1cccc(C)c1.
What is the InChIKey of 1-methyl-3-propylbenzene;prop-2-enenitrile?
The InChIKey is UVEDFGYGGNNDGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C3H3N/c1-3-5-10-7-4-6-9(2)8-10;1-2-3-4/h4,6-8H,3,5H2,1-2H3;2H,1H2.
What are the key properties of 1-methyl-3-propylbenzene;prop-2-enenitrile?
1-methyl-3-propylbenzene;prop-2-enenitrile has a molecular weight of 187.29 g/mol, XLogP of 3.64, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-propylbenzene;prop-2-enenitrile is sourced from PubChem (CID 144542987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).