About 3-methylbut-1-ene;3-propylbenzonitrile
3-methylbut-1-ene;3-propylbenzonitrile (PubChem CID 164902179) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-methylbut-1-ene;3-propylbenzonitrile.
Molecular Properties
| Compound Name | 3-methylbut-1-ene;3-propylbenzonitrile |
| PubChem CID | 164902179 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3-methylbut-1-ene;3-propylbenzonitrile |
| SMILES | C=CC(C)C.CCCc1cccc(C#N)c1 |
| InChI | InChI=1S/C10H11N.C5H10/c1-2-4-9-5-3-6-10(7-9)8-11;1-4-5(2)3/h3,5-7H,2,4H2,1H3;4-5H,1H2,2-3H3 |
| InChIKey | HLQXBLZDGUPKST-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-1-ene;3-propylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-1-ene;3-propylbenzonitrile?
The IUPAC name of 3-methylbut-1-ene;3-propylbenzonitrile (CID 164902179) is 3-methylbut-1-ene;3-propylbenzonitrile.
What is the SMILES notation for 3-methylbut-1-ene;3-propylbenzonitrile?
The canonical SMILES for 3-methylbut-1-ene;3-propylbenzonitrile is C=CC(C)C.CCCc1cccc(C#N)c1.
What is the InChIKey of 3-methylbut-1-ene;3-propylbenzonitrile?
The InChIKey is HLQXBLZDGUPKST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.C5H10/c1-2-4-9-5-3-6-10(7-9)8-11;1-4-5(2)3/h3,5-7H,2,4H2,1H3;4-5H,1H2,2-3H3.
What are the key properties of 3-methylbut-1-ene;3-propylbenzonitrile?
3-methylbut-1-ene;3-propylbenzonitrile has a molecular weight of 215.34 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-1-ene;3-propylbenzonitrile is sourced from PubChem (CID 164902179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).