About but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene
but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene (PubChem CID 177034682) has the molecular formula C20H25FO
and a molecular weight of 300.42 g/mol. Its IUPAC name is but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene.
Molecular Properties
| Compound Name | but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene |
| PubChem CID | 177034682 |
| Molecular Formula | C20H25FO |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene |
| SMILES | C=CC(C)=O.CCCc1ccccc1.Cc1cccc(F)c1 |
| InChI | InChI=1S/C9H12.C7H7F.C4H6O/c1-2-6-9-7-4-3-5-8-9;1-6-3-2-4-7(8)5-6;1-3-4(2)5/h3-5,7-8H,2,6H2,1H3;2-5H,1H3;3H,1H2,2H3 |
| InChIKey | YERDCUPALBVLAO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene?
The IUPAC name of but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene (CID 177034682) is but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene.
What is the SMILES notation for but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene?
The canonical SMILES for but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene is C=CC(C)=O.CCCc1ccccc1.Cc1cccc(F)c1.
What is the InChIKey of but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene?
The InChIKey is YERDCUPALBVLAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C7H7F.C4H6O/c1-2-6-9-7-4-3-5-8-9;1-6-3-2-4-7(8)5-6;1-3-4(2)5/h3-5,7-8H,2,6H2,1H3;2-5H,1H3;3H,1H2,2H3.
What are the key properties of but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene?
but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene has a molecular weight of 300.42 g/mol, XLogP of 5.53, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-one;1-fluoro-3-methylbenzene;propylbenzene is sourced from PubChem (CID 177034682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).