C22H27BrO — CID 177034735
1-bromo-4-propylbenzene;penta-3,4-dien-2-one;1,3-xylene (PubChem CID 177034735) has the molecular formula C22H27BrO and a molecular weight of 387.36 g/mol. Its IUPAC name is 1-bromo-4-propylbenzene;penta-3,4-dien-2-one;1,3-xylene.
| Compound Name | 1-bromo-4-propylbenzene;penta-3,4-dien-2-one;1,3-xylene |
|---|---|
| PubChem CID | 177034735 |
| Molecular Formula | C22H27BrO |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 1-bromo-4-propylbenzene;penta-3,4-dien-2-one;1,3-xylene |
| SMILES | C=C=CC(C)=O.CCCc1ccc(Br)cc1.Cc1cccc(C)c1 |
| InChI | InChI=1S/C9H11Br.C8H10.C5H6O/c1-2-3-8-4-6-9(10)7-5-8;1-7-4-3-5-8(2)6-7;1-3-4-5(2)6/h4-7H,2-3H2,1H3;3-6H,1-2H3;4H,1H2,2H3 |
| InChIKey | YXGCMUBNHIDZLX-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|