C23H22BrNO2 — CID 89403920
3-[4-(4-bromo-N-(3-methylphenyl)anilino)phenyl]propyl formate (PubChem CID 89403920) has the molecular formula C23H22BrNO2 and a molecular weight of 424.34 g/mol. Its IUPAC name is 3-[4-(4-bromo-N-(3-methylphenyl)anilino)phenyl]propyl formate.
| Compound Name | 3-[4-(4-bromo-N-(3-methylphenyl)anilino)phenyl]propyl formate |
|---|---|
| PubChem CID | 89403920 |
| Molecular Formula | C23H22BrNO2 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 3-[4-(4-bromo-N-(3-methylphenyl)anilino)phenyl]propyl formate |
| SMILES | Cc1cccc(N(c2ccc(Br)cc2)c2ccc(CCCOC=O)cc2)c1 |
| InChI | InChI=1S/C23H22BrNO2/c1-18-4-2-6-23(16-18)25(22-13-9-20(24)10-14-22)21-11-7-19(8-12-21)5-3-15-27-17-26/h2,4,6-14,16-17H,3,5,15H2,1H3 |
| InChIKey | AXMZIJLQFIUCSU-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|