About 3-(4-aminophenyl)propyl formate
3-(4-aminophenyl)propyl formate (PubChem CID 87851882) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-(4-aminophenyl)propyl formate.
Molecular Properties
| Compound Name | 3-(4-aminophenyl)propyl formate |
| PubChem CID | 87851882 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 3-(4-aminophenyl)propyl formate |
| SMILES | Nc1ccc(CCCOC=O)cc1 |
| InChI | InChI=1S/C10H13NO2/c11-10-5-3-9(4-6-10)2-1-7-13-8-12/h3-6,8H,1-2,7,11H2 |
| InChIKey | OSOCEUCJHFTHOR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminophenyl)propyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminophenyl)propyl formate?
The IUPAC name of 3-(4-aminophenyl)propyl formate (CID 87851882) is 3-(4-aminophenyl)propyl formate.
What is the SMILES notation for 3-(4-aminophenyl)propyl formate?
The canonical SMILES for 3-(4-aminophenyl)propyl formate is Nc1ccc(CCCOC=O)cc1.
What is the InChIKey of 3-(4-aminophenyl)propyl formate?
The InChIKey is OSOCEUCJHFTHOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c11-10-5-3-9(4-6-10)2-1-7-13-8-12/h3-6,8H,1-2,7,11H2.
What are the key properties of 3-(4-aminophenyl)propyl formate?
3-(4-aminophenyl)propyl formate has a molecular weight of 179.22 g/mol, XLogP of 1.37, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminophenyl)propyl formate is sourced from PubChem (CID 87851882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).