C15H18N2O3 — CID 115946982
1-[(3-methylphenyl)methyl]-5-propyl-1,3-diazinane-2,4,6-trione (PubChem CID 115946982) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-5-propyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[(3-methylphenyl)methyl]-5-propyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 115946982 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-5-propyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCC1C(=O)NC(=O)N(Cc2cccc(C)c2)C1=O |
| InChI | InChI=1S/C15H18N2O3/c1-3-5-12-13(18)16-15(20)17(14(12)19)9-11-7-4-6-10(2)8-11/h4,6-8,12H,3,5,9H2,1-2H3,(H,16,18,20) |
| InChIKey | ZFIHZBGYSAYNCZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|