C13H13NO2 — CID 60902619
3-methyl-1-[(3-methylphenyl)methyl]pyrrole-2,5-dione (PubChem CID 60902619) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-methyl-1-[(3-methylphenyl)methyl]pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-[(3-methylphenyl)methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 60902619 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 3-methyl-1-[(3-methylphenyl)methyl]pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(Cc2cccc(C)c2)C1=O |
| InChI | InChI=1S/C13H13NO2/c1-9-4-3-5-11(6-9)8-14-12(15)7-10(2)13(14)16/h3-7H,8H2,1-2H3 |
| InChIKey | XZMKXAWPWNPKSO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|