C17H14N2O6 — CID 178053147
formic acid;2-[(3-methylphenyl)methyl]-4-nitroisoindole-1,3-dione (PubChem CID 178053147) has the molecular formula C17H14N2O6 and a molecular weight of 342.31 g/mol. Its IUPAC name is formic acid;2-[(3-methylphenyl)methyl]-4-nitroisoindole-1,3-dione.
| Compound Name | formic acid;2-[(3-methylphenyl)methyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 178053147 |
| Molecular Formula | C17H14N2O6 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | formic acid;2-[(3-methylphenyl)methyl]-4-nitroisoindole-1,3-dione |
| SMILES | Cc1cccc(CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c1.O=CO |
| InChI | InChI=1S/C16H12N2O4.CH2O2/c1-10-4-2-5-11(8-10)9-17-15(19)12-6-3-7-13(18(21)22)14(12)16(17)20;2-1-3/h2-8H,9H2,1H3;1H,(H,2,3) |
| InChIKey | UVAIAVVEBOEZEB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|