C18H16N2O5 — CID 18171186
2-[2-(3,5-dimethylphenoxy)ethyl]-4-nitroisoindole-1,3-dione (PubChem CID 18171186) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylphenoxy)ethyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-(3,5-dimethylphenoxy)ethyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 18171186 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[2-(3,5-dimethylphenoxy)ethyl]-4-nitroisoindole-1,3-dione |
| SMILES | Cc1cc(C)cc(OCCN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c1 |
| InChI | InChI=1S/C18H16N2O5/c1-11-8-12(2)10-13(9-11)25-7-6-19-17(21)14-4-3-5-15(20(23)24)16(14)18(19)22/h3-5,8-10H,6-7H2,1-2H3 |
| InChIKey | MPLUOMGZUAVUIJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|