C23H22N4O3 — CID 42330544
3-ethyl-1-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]quinazoline-2,4-dione (PubChem CID 42330544) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-ethyl-1-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]quinazoline-2,4-dione.
| Compound Name | 3-ethyl-1-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 42330544 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-ethyl-1-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]quinazoline-2,4-dione |
| SMILES | CCn1c(=O)c2ccccc2n(CC(=O)N2CCc3[nH]c4ccccc4c3C2)c1=O |
| InChI | InChI=1S/C23H22N4O3/c1-2-26-22(29)16-8-4-6-10-20(16)27(23(26)30)14-21(28)25-12-11-19-17(13-25)15-7-3-5-9-18(15)24-19/h3-10,24H,2,11-14H2,1H3 |
| InChIKey | AQBMYFSVQBNLCY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 80.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|