C21H27N3O3 — CID 9490062
1-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-ethylquinazoline-2,4-dione (PubChem CID 9490062) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-ethylquinazoline-2,4-dione.
| Compound Name | 1-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-ethylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 9490062 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-ethylquinazoline-2,4-dione |
| SMILES | CCn1c(=O)c2ccccc2n(CC(=O)N2CC[C@@H]3CCCC[C@@H]3C2)c1=O |
| InChI | InChI=1S/C21H27N3O3/c1-2-23-20(26)17-9-5-6-10-18(17)24(21(23)27)14-19(25)22-12-11-15-7-3-4-8-16(15)13-22/h5-6,9-10,15-16H,2-4,7-8,11-14H2,1H3/t15-,16+/m0/s1 |
| InChIKey | TZZNWJSWSQNPTH-JKSUJKDBSA-N |
| XLogP | 2.22 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |