C25H31N5O3 — CID 25324911
1-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-benzyl-7-ethylpurine-2,6-dione (PubChem CID 25324911) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 1-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-benzyl-7-ethylpurine-2,6-dione.
| Compound Name | 1-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-benzyl-7-ethylpurine-2,6-dione |
|---|---|
| PubChem CID | 25324911 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 1-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-3-benzyl-7-ethylpurine-2,6-dione |
| SMILES | CCn1cnc2c1c(=O)n(CC(=O)N1CC[C@H]3CCCC[C@@H]3C1)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C25H31N5O3/c1-2-27-17-26-23-22(27)24(32)30(25(33)29(23)14-18-8-4-3-5-9-18)16-21(31)28-13-12-19-10-6-7-11-20(19)15-28/h3-5,8-9,17,19-20H,2,6-7,10-16H2,1H3/t19-,20-/m1/s1 |
| InChIKey | GUBPQPRYVLWJFE-WOJBJXKFSA-N |
| XLogP | 2.47 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |