C20H27N3O4 — CID 51046817
3-(3-methoxypropyl)-1-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]quinazoline-2,4-dione (PubChem CID 51046817) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-1-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]quinazoline-2,4-dione.
| Compound Name | 3-(3-methoxypropyl)-1-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 51046817 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 3-(3-methoxypropyl)-1-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]quinazoline-2,4-dione |
| SMILES | COCCCn1c(=O)c2ccccc2n(CC(=O)N2CCCC(C)C2)c1=O |
| InChI | InChI=1S/C20H27N3O4/c1-15-7-5-10-21(13-15)18(24)14-23-17-9-4-3-8-16(17)19(25)22(20(23)26)11-6-12-27-2/h3-4,8-9,15H,5-7,10-14H2,1-2H3 |
| InChIKey | OTKKLUAIMRLFDJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|