C22H29N3O6 — CID 51046827
ethyl 1-[2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]acetyl]piperidine-4-carboxylate (PubChem CID 51046827) has the molecular formula C22H29N3O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is ethyl 1-[2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 51046827 |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | ethyl 1-[2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)Cn2c(=O)n(CCCOC)c(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C22H29N3O6/c1-3-31-21(28)16-9-12-23(13-10-16)19(26)15-25-18-8-5-4-7-17(18)20(27)24(22(25)29)11-6-14-30-2/h4-5,7-8,16H,3,6,9-15H2,1-2H3 |
| InChIKey | RLVGQVKORQBBQG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 99.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|