C24H29N3O4 — CID 51046823
N-ethyl-N-(4-ethylphenyl)-2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]acetamide (PubChem CID 51046823) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is N-ethyl-N-(4-ethylphenyl)-2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]acetamide.
| Compound Name | N-ethyl-N-(4-ethylphenyl)-2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]acetamide |
|---|---|
| PubChem CID | 51046823 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-ethyl-N-(4-ethylphenyl)-2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]acetamide |
| SMILES | CCc1ccc(N(CC)C(=O)Cn2c(=O)n(CCCOC)c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H29N3O4/c1-4-18-11-13-19(14-12-18)25(5-2)22(28)17-27-21-10-7-6-9-20(21)23(29)26(24(27)30)15-8-16-31-3/h6-7,9-14H,4-5,8,15-17H2,1-3H3 |
| InChIKey | PTIHPZUBYZXOCW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|